C40H48N2O5 — CID 160952058
benzyl 2-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)acetate;benzyl 2-(2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl)acetate;methanol (PubChem CID 160952058) has the molecular formula C40H48N2O5 and a molecular weight of 636.83 g/mol. Its IUPAC name is benzyl 2-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)acetate;benzyl 2-(2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl)acetate;methanol.
| Compound Name | benzyl 2-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)acetate;benzyl 2-(2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl)acetate;methanol |
|---|---|
| PubChem CID | 160952058 |
| Molecular Formula | C40H48N2O5 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | benzyl 2-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl)acetate;benzyl 2-(2,3,4,5-tetrahydro-1H-2-benzazepin-8-yl)acetate;methanol |
| SMILES | CN1CCCc2ccc(CC(=O)OCc3ccccc3)cc2C1.CO.O=C(Cc1ccc2c(c1)CNCCC2)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2.C19H21NO2.CH4O/c1-21-11-5-8-18-10-9-17(12-19(18)14-21)13-20(22)23-15-16-6-3-2-4-7-16;21-19(22-14-15-5-2-1-3-6-15)12-16-8-9-17-7-4-10-20-13-18(17)11-16;1-2/h2-4,6-7,9-10,12H,5,8,11,13-15H2,1H3;1-3,5-6,8-9,11,20H,4,7,10,12-14H2;2H,1H3 |
| InChIKey | SVWSHBCPTWBUOX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |