C30H29ClF3NO6 — CID 160952492
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4-hydroxy-4-methylcyclohexyl)-2-oxobutyl]benzoic acid (PubChem CID 160952492) has the molecular formula C30H29ClF3NO6 and a molecular weight of 592.01 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4-hydroxy-4-methylcyclohexyl)-2-oxobutyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4-hydroxy-4-methylcyclohexyl)-2-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 160952492 |
| Molecular Formula | C30H29ClF3NO6 |
| Molecular Weight | 592.01 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-(4-hydroxy-4-methylcyclohexyl)-2-oxobutyl]benzoic acid |
| SMILES | CC1(O)CCC(CC(C(=O)Cc2ccc(C(=O)O)cc2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])CC1 |
| InChI | InChI=1S/C30H29ClF3NO6/c1-30(39)12-10-18(11-13-30)14-21(24(36)15-17-2-4-19(5-3-17)28(37)38)23-8-6-20(16-35(23)40)26-25(41-29(33)34)9-7-22(31)27(26)32/h2-9,16,18,21,29,39H,10-15H2,1H3,(H,37,38) |
| InChIKey | SVYGTZSGBBILGX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.01 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|