C24H42N2O — CID 160952610
4-(2-bicyclo[2.2.1]heptanyl)pentan-2-one;1-(2-bicyclo[2.2.1]heptanyl)-N-(propan-2-ylideneamino)ethanamine (PubChem CID 160952610) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanyl)pentan-2-one;1-(2-bicyclo[2.2.1]heptanyl)-N-(propan-2-ylideneamino)ethanamine.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanyl)pentan-2-one;1-(2-bicyclo[2.2.1]heptanyl)-N-(propan-2-ylideneamino)ethanamine |
|---|---|
| PubChem CID | 160952610 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanyl)pentan-2-one;1-(2-bicyclo[2.2.1]heptanyl)-N-(propan-2-ylideneamino)ethanamine |
| SMILES | CC(=O)CC(C)C1CC2CCC1C2.CC(C)=NNC(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H22N2.C12H20O/c1-8(2)13-14-9(3)12-7-10-4-5-11(12)6-10;1-8(5-9(2)13)12-7-10-3-4-11(12)6-10/h9-12,14H,4-7H2,1-3H3;8,10-12H,3-7H2,1-2H3 |
| InChIKey | SVYQJRQEPPCOJX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|