C12H28O7 — CID 160953059
2,2-dimethoxypropan-1-ol;2-(2,2-dimethoxypropoxy)ethanol (PubChem CID 160953059) has the molecular formula C12H28O7 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2,2-dimethoxypropan-1-ol;2-(2,2-dimethoxypropoxy)ethanol.
| Compound Name | 2,2-dimethoxypropan-1-ol;2-(2,2-dimethoxypropoxy)ethanol |
|---|---|
| PubChem CID | 160953059 |
| Molecular Formula | C12H28O7 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2,2-dimethoxypropan-1-ol;2-(2,2-dimethoxypropoxy)ethanol |
| SMILES | COC(C)(CO)OC.COC(C)(COCCO)OC |
| InChI | InChI=1S/C7H16O4.C5H12O3/c1-7(9-2,10-3)6-11-5-4-8;1-5(4-6,7-2)8-3/h8H,4-6H2,1-3H3;6H,4H2,1-3H3 |
| InChIKey | SWABUUQWAXCZDO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|