C36H28BO4 — CID 160958346
CID 160958346 (PubChem CID 160958346) has the molecular formula C36H28BO4 and a molecular weight of 535.43 g/mol.
| Compound Name | CID 160958346 |
|---|---|
| PubChem CID | 160958346 |
| Molecular Formula | C36H28BO4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2(c3ccccc3)C=Cc3c4c(c5cc6c(cc5c3O2)OCC6)-c2ccccc2C4(C)O)cc1.[B] |
| InChI | InChI=1S/C36H28O4.B/c1-35(37)30-11-7-6-10-26(30)32-28-20-22-17-19-39-31(22)21-29(28)34-27(33(32)35)16-18-36(40-34,23-8-4-3-5-9-23)24-12-14-25(38-2)15-13-24;/h3-16,18,20-21,37H,17,19H2,1-2H3; |
| InChIKey | GDORCQSRXYAFIS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|