C36H27ClO3 — CID 59086784
9-chloro-14,14-bis(4-methylphenyl)-15,20-dioxahexacyclo[15.7.0.02,10.03,8.011,16.019,23]tetracosa-1(17),2(10),3,5,7,11(16),12,18,23-nonaen-9-ol (PubChem CID 59086784) has the molecular formula C36H27ClO3 and a molecular weight of 543.06 g/mol. Its IUPAC name is 9-chloro-14,14-bis(4-methylphenyl)-15,20-dioxahexacyclo[15.7.0.02,10.03,8.011,16.019,23]tetracosa-1(17),2(10),3,5,7,11(16),12,18,23-nonaen-9-ol.
| Compound Name | 9-chloro-14,14-bis(4-methylphenyl)-15,20-dioxahexacyclo[15.7.0.02,10.03,8.011,16.019,23]tetracosa-1(17),2(10),3,5,7,11(16),12,18,23-nonaen-9-ol |
|---|---|
| PubChem CID | 59086784 |
| Molecular Formula | C36H27ClO3 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 9-chloro-14,14-bis(4-methylphenyl)-15,20-dioxahexacyclo[15.7.0.02,10.03,8.011,16.019,23]tetracosa-1(17),2(10),3,5,7,11(16),12,18,23-nonaen-9-ol |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)C=Cc3c4c(c5cc6c(cc5c3O2)OCC6)-c2ccccc2C4(O)Cl)cc1 |
| InChI | InChI=1S/C36H27ClO3/c1-21-7-11-24(12-8-21)35(25-13-9-22(2)10-14-25)17-15-27-33-32(26-5-3-4-6-30(26)36(33,37)38)28-19-23-16-18-39-31(23)20-29(28)34(27)40-35/h3-15,17,19-20,38H,16,18H2,1-2H3 |
| InChIKey | DKLLLKDGILPPJS-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|