C12H15N3Ru+3 — CID 160958444
1-methyl-5-phenyl-3-propyl-1,2,4-triazole;ruthenium(3+) (PubChem CID 160958444) has the molecular formula C12H15N3Ru+3 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-methyl-5-phenyl-3-propyl-1,2,4-triazole;ruthenium(3+).
| Compound Name | 1-methyl-5-phenyl-3-propyl-1,2,4-triazole;ruthenium(3+) |
|---|---|
| PubChem CID | 160958444 |
| Molecular Formula | C12H15N3Ru+3 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-methyl-5-phenyl-3-propyl-1,2,4-triazole;ruthenium(3+) |
| SMILES | CCCc1nc(-c2ccccc2)n(C)n1.[Ru+3] |
| InChI | InChI=1S/C12H15N3.Ru/c1-3-7-11-13-12(15(2)14-11)10-8-5-4-6-9-10;/h4-6,8-9H,3,7H2,1-2H3;/q;+3 |
| InChIKey | SWRWSLPNFBZKIM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |