C13H15N3O2 — CID 55111470
2-(2-methyl-5-propyl-1,2,4-triazol-3-yl)benzoic acid (PubChem CID 55111470) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(2-methyl-5-propyl-1,2,4-triazol-3-yl)benzoic acid.
| Compound Name | 2-(2-methyl-5-propyl-1,2,4-triazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 55111470 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(2-methyl-5-propyl-1,2,4-triazol-3-yl)benzoic acid |
| SMILES | CCCc1nc(-c2ccccc2C(=O)O)n(C)n1 |
| InChI | InChI=1S/C13H15N3O2/c1-3-6-11-14-12(16(2)15-11)9-7-4-5-8-10(9)13(17)18/h4-5,7-8H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | FGFYHWFYXACVKD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |