C24H23N3O2 — CID 151315426
2-[4-(2-butyl-5-methylimidazo[4,5-b]pyridin-4-yl)phenyl]benzoic acid (PubChem CID 151315426) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[4-(2-butyl-5-methylimidazo[4,5-b]pyridin-4-yl)phenyl]benzoic acid.
| Compound Name | 2-[4-(2-butyl-5-methylimidazo[4,5-b]pyridin-4-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 151315426 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-[4-(2-butyl-5-methylimidazo[4,5-b]pyridin-4-yl)phenyl]benzoic acid |
| SMILES | CCCCc1nc2ccc(C)n(-c3ccc(-c4ccccc4C(=O)O)cc3)c-2n1 |
| InChI | InChI=1S/C24H23N3O2/c1-3-4-9-22-25-21-15-10-16(2)27(23(21)26-22)18-13-11-17(12-14-18)19-7-5-6-8-20(19)24(28)29/h5-8,10-15H,3-4,9H2,1-2H3,(H,28,29) |
| InChIKey | OFHWDPFNUQUCSG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |