C30H32N2O4 — CID 15069341
2-[4-[(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 15069341) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[4-[(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 15069341 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[4-[(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc2c(C)ccc(OC(=O)CCC)c2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-4-6-12-26-31-28-20(3)13-18-25(36-27(33)9-5-2)29(28)32(26)19-21-14-16-22(17-15-21)23-10-7-8-11-24(23)30(34)35/h7-8,10-11,13-18H,4-6,9,12,19H2,1-3H3,(H,34,35) |
| InChIKey | SPMSBQRVHDHEKE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|