C33H38N4O5 — CID 70051797
[2-[4-[[2-butyl-7-(4-imidazol-1-ylbutoxy)-4-methylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;hydrate (PubChem CID 70051797) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is [2-[4-[[2-butyl-7-(4-imidazol-1-ylbutoxy)-4-methylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;hydrate.
| Compound Name | [2-[4-[[2-butyl-7-(4-imidazol-1-ylbutoxy)-4-methylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;hydrate |
|---|---|
| PubChem CID | 70051797 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [2-[4-[[2-butyl-7-(4-imidazol-1-ylbutoxy)-4-methylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;hydrate |
| SMILES | CCCCc1nc2c(C)ccc(OCCCCn3ccnc3)c2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1.O |
| InChI | InChI=1S/C33H36N4O4.H2O/c1-3-4-11-30-35-31-24(2)12-17-29(40-21-8-7-19-36-20-18-34-23-36)32(31)37(30)22-25-13-15-26(16-14-25)27-9-5-6-10-28(27)41-33(38)39;/h5-6,9-10,12-18,20,23H,3-4,7-8,11,19,21-22H2,1-2H3,(H,38,39);1H2 |
| InChIKey | SUUJGPWKCSGVNU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|