C34H38N8O — CID 54306893
2-butyl-7-(5-imidazol-1-ylpentoxy)-4-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole (PubChem CID 54306893) has the molecular formula C34H38N8O and a molecular weight of 574.73 g/mol. Its IUPAC name is 2-butyl-7-(5-imidazol-1-ylpentoxy)-4-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole.
| Compound Name | 2-butyl-7-(5-imidazol-1-ylpentoxy)-4-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 54306893 |
| Molecular Formula | C34H38N8O |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 2-butyl-7-(5-imidazol-1-ylpentoxy)-4-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole |
| SMILES | CCCCc1nc2c(C)ccc(OCCCCCn3ccnc3)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H38N8O/c1-3-4-12-31-36-32-25(2)13-18-30(43-22-9-5-8-20-41-21-19-35-24-41)33(32)42(31)23-26-14-16-27(17-15-26)28-10-6-7-11-29(28)34-37-39-40-38-34/h6-7,10-11,13-19,21,24H,3-5,8-9,12,20,22-23H2,1-2H3,(H,37,38,39,40) |
| InChIKey | SIDXMANSEXFKDY-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|