C30H32N2O4 — CID 67573422
2-[4-(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)-2-methylphenyl]benzoic acid (PubChem CID 67573422) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[4-(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67573422 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[4-(7-butanoyloxy-2-butyl-4-methylbenzimidazol-1-yl)-2-methylphenyl]benzoic acid |
| SMILES | CCCCc1nc2c(C)ccc(OC(=O)CCC)c2n1-c1ccc(-c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C30H32N2O4/c1-5-7-13-26-31-28-19(3)14-17-25(36-27(33)10-6-2)29(28)32(26)21-15-16-22(20(4)18-21)23-11-8-9-12-24(23)30(34)35/h8-9,11-12,14-18H,5-7,10,13H2,1-4H3,(H,34,35) |
| InChIKey | CANZLBMGXCXQRO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|