C30H33N3O3 — CID 67573448
2-[4-[2-butyl-6-(pentanoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid (PubChem CID 67573448) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[4-[2-butyl-6-(pentanoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-[2-butyl-6-(pentanoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67573448 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-[4-[2-butyl-6-(pentanoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
| SMILES | CCCCC(=O)Nc1ccc2nc(CCCC)n(-c3ccc(-c4ccccc4C(=O)O)c(C)c3)c2c1 |
| InChI | InChI=1S/C30H33N3O3/c1-4-6-12-28-32-26-17-14-21(31-29(34)13-7-5-2)19-27(26)33(28)22-15-16-23(20(3)18-22)24-10-8-9-11-25(24)30(35)36/h8-11,14-19H,4-7,12-13H2,1-3H3,(H,31,34)(H,35,36) |
| InChIKey | KLGDFMIWHDNFLX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |