C32H35N3O3 — CID 67572437
2-[4-[2-butyl-6-(cyclohexylcarbamoyl)benzimidazol-1-yl]-2-methylphenyl]benzoic acid (PubChem CID 67572437) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is 2-[4-[2-butyl-6-(cyclohexylcarbamoyl)benzimidazol-1-yl]-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-[2-butyl-6-(cyclohexylcarbamoyl)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67572437 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 2-[4-[2-butyl-6-(cyclohexylcarbamoyl)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
| SMILES | CCCCc1nc2ccc(C(=O)NC3CCCCC3)cc2n1-c1ccc(-c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C32H35N3O3/c1-3-4-14-30-34-28-18-15-22(31(36)33-23-10-6-5-7-11-23)20-29(28)35(30)24-16-17-25(21(2)19-24)26-12-8-9-13-27(26)32(37)38/h8-9,12-13,15-20,23H,3-7,10-11,14H2,1-2H3,(H,33,36)(H,37,38) |
| InChIKey | YBWOBFFEWPDUDF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |