C25H23ClN2O2 — CID 67572433
2-[4-(2-butyl-6-chlorobenzimidazol-1-yl)-2-methylphenyl]benzoic acid (PubChem CID 67572433) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-[4-(2-butyl-6-chlorobenzimidazol-1-yl)-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-(2-butyl-6-chlorobenzimidazol-1-yl)-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67572433 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[4-(2-butyl-6-chlorobenzimidazol-1-yl)-2-methylphenyl]benzoic acid |
| SMILES | CCCCc1nc2ccc(Cl)cc2n1-c1ccc(-c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-3-4-9-24-27-22-13-10-17(26)15-23(22)28(24)18-11-12-19(16(2)14-18)20-7-5-6-8-21(20)25(29)30/h5-8,10-15H,3-4,9H2,1-2H3,(H,29,30) |
| InChIKey | POADPEJAJCYRPH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |