C29H31N3O3 — CID 67573364
2-[4-[2-butyl-5-[methyl(propanoyl)amino]benzimidazol-1-yl]-2-methylphenyl]benzoic acid (PubChem CID 67573364) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[4-[2-butyl-5-[methyl(propanoyl)amino]benzimidazol-1-yl]-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-[2-butyl-5-[methyl(propanoyl)amino]benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67573364 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[4-[2-butyl-5-[methyl(propanoyl)amino]benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
| SMILES | CCCCc1nc2cc(N(C)C(=O)CC)ccc2n1-c1ccc(-c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C29H31N3O3/c1-5-7-12-27-30-25-18-20(31(4)28(33)6-2)14-16-26(25)32(27)21-13-15-22(19(3)17-21)23-10-8-9-11-24(23)29(34)35/h8-11,13-18H,5-7,12H2,1-4H3,(H,34,35) |
| InChIKey | GSDVDNWKPSFFCC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |