C28H30N4O3 — CID 67573539
2-[4-[2-butyl-4-(ethylcarbamoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid (PubChem CID 67573539) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[4-[2-butyl-4-(ethylcarbamoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid.
| Compound Name | 2-[4-[2-butyl-4-(ethylcarbamoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 67573539 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[4-[2-butyl-4-(ethylcarbamoylamino)benzimidazol-1-yl]-2-methylphenyl]benzoic acid |
| SMILES | CCCCc1nc2c(NC(=O)NCC)cccc2n1-c1ccc(-c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C28H30N4O3/c1-4-6-14-25-31-26-23(30-28(35)29-5-2)12-9-13-24(26)32(25)19-15-16-20(18(3)17-19)21-10-7-8-11-22(21)27(33)34/h7-13,15-17H,4-6,14H2,1-3H3,(H,33,34)(H2,29,30,35) |
| InChIKey | XLULIDZWUUODDQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |