C26H30N14S2 — CID 160959097
8-(4-methylpiperazin-1-yl)-5-thiophen-2-yltetrazolo[1,5-a]pyrazine (PubChem CID 160959097) has the molecular formula C26H30N14S2 and a molecular weight of 602.76 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-5-thiophen-2-yltetrazolo[1,5-a]pyrazine.
| Compound Name | 8-(4-methylpiperazin-1-yl)-5-thiophen-2-yltetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 160959097 |
| Molecular Formula | C26H30N14S2 |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-5-thiophen-2-yltetrazolo[1,5-a]pyrazine |
| SMILES | CN1CCN(c2ncc(-c3cccs3)n3nnnc23)CC1.CN1CCN(c2ncc(-c3cccs3)n3nnnc23)CC1 |
| InChI | InChI=1S/2C13H15N7S/c2*1-18-4-6-19(7-5-18)12-13-15-16-17-20(13)10(9-14-12)11-3-2-8-21-11/h2*2-3,8-9H,4-7H2,1H3 |
| InChIKey | SWTZHPVGKGTWLL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 124.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |