C69H45N9 — CID 160961914
4-(5,6-diphenylpyrazin-2-yl)benzonitrile;5-(2-isocyanophenyl)-2,3-diphenylpyrazine;5-(3-isocyanophenyl)-2,3-diphenylpyrazine (PubChem CID 160961914) has the molecular formula C69H45N9 and a molecular weight of 1000.18 g/mol. Its IUPAC name is 4-(5,6-diphenylpyrazin-2-yl)benzonitrile;5-(2-isocyanophenyl)-2,3-diphenylpyrazine;5-(3-isocyanophenyl)-2,3-diphenylpyrazine.
| Compound Name | 4-(5,6-diphenylpyrazin-2-yl)benzonitrile;5-(2-isocyanophenyl)-2,3-diphenylpyrazine;5-(3-isocyanophenyl)-2,3-diphenylpyrazine |
|---|---|
| PubChem CID | 160961914 |
| Molecular Formula | C69H45N9 |
| Molecular Weight | 1000.18 g/mol |
| Exact Mass | 999.38 |
| IUPAC Name | 4-(5,6-diphenylpyrazin-2-yl)benzonitrile;5-(2-isocyanophenyl)-2,3-diphenylpyrazine;5-(3-isocyanophenyl)-2,3-diphenylpyrazine |
| SMILES | N#Cc1ccc(-c2cnc(-c3ccccc3)c(-c3ccccc3)n2)cc1.[C-]#[N+]c1cccc(-c2cnc(-c3ccccc3)c(-c3ccccc3)n2)c1.[C-]#[N+]c1ccccc1-c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/3C23H15N3/c1-24-20-15-9-8-14-19(20)21-16-25-22(17-10-4-2-5-11-17)23(26-21)18-12-6-3-7-13-18;1-24-20-14-8-13-19(15-20)21-16-25-22(17-9-4-2-5-10-17)23(26-21)18-11-6-3-7-12-18;24-15-17-11-13-18(14-12-17)21-16-25-22(19-7-3-1-4-8-19)23(26-21)20-9-5-2-6-10-20/h2*2-16H;1-14,16H |
| InChIKey | SXCOYMNFELVKSK-UHFFFAOYSA-N |
| XLogP | 17.41 |
| TPSA | 109.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.18 |
| LogP ≤ 5 | 17.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|