C23H43N3O9 — CID 160966622
2-amino-2-(hydroxymethyl)propane-1,3-diol;4-[2-amino-3-(3-oxobutoxy)-2-(3-oxobutoxymethyl)propoxy]butan-2-one;prop-2-enenitrile (PubChem CID 160966622) has the molecular formula C23H43N3O9 and a molecular weight of 505.61 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-[2-amino-3-(3-oxobutoxy)-2-(3-oxobutoxymethyl)propoxy]butan-2-one;prop-2-enenitrile.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-[2-amino-3-(3-oxobutoxy)-2-(3-oxobutoxymethyl)propoxy]butan-2-one;prop-2-enenitrile |
|---|---|
| PubChem CID | 160966622 |
| Molecular Formula | C23H43N3O9 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;4-[2-amino-3-(3-oxobutoxy)-2-(3-oxobutoxymethyl)propoxy]butan-2-one;prop-2-enenitrile |
| SMILES | C=CC#N.CC(=O)CCOCC(N)(COCCC(C)=O)COCCC(C)=O.NC(CO)(CO)CO |
| InChI | InChI=1S/C16H29NO6.C4H11NO3.C3H3N/c1-13(18)4-7-21-10-16(17,11-22-8-5-14(2)19)12-23-9-6-15(3)20;5-4(1-6,2-7)3-8;1-2-3-4/h4-12,17H2,1-3H3;6-8H,1-3,5H2;2H,1H2 |
| InChIKey | SXSBLSNRNNOKBL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 215.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|