C16H17ClN4O2 — CID 160967962
(6-chloro-3-pyridinyl)methanol;[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanol (PubChem CID 160967962) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methanol;[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanol.
| Compound Name | (6-chloro-3-pyridinyl)methanol;[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 160967962 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (6-chloro-3-pyridinyl)methanol;[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanol |
| SMILES | Cn1cc(-c2ccc(CO)cn2)cn1.OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11N3O.C6H6ClNO/c1-13-6-9(5-12-13)10-3-2-8(7-14)4-11-10;7-6-2-1-5(4-9)3-8-6/h2-6,14H,7H2,1H3;1-3,9H,4H2 |
| InChIKey | SXWJHTCENJKLDA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|