C15H14N4O3S — CID 160971496
[4-[1-(4-methylphenyl)triazol-4-yl]phenyl] sulfamate (PubChem CID 160971496) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is [4-[1-(4-methylphenyl)triazol-4-yl]phenyl] sulfamate.
| Compound Name | [4-[1-(4-methylphenyl)triazol-4-yl]phenyl] sulfamate |
|---|---|
| PubChem CID | 160971496 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [4-[1-(4-methylphenyl)triazol-4-yl]phenyl] sulfamate |
| SMILES | Cc1ccc(-n2cc(-c3ccc(OS(N)(=O)=O)cc3)nn2)cc1 |
| InChI | InChI=1S/C15H14N4O3S/c1-11-2-6-13(7-3-11)19-10-15(17-18-19)12-4-8-14(9-5-12)22-23(16,20)21/h2-10H,1H3,(H2,16,20,21) |
| InChIKey | SYHUJHWPQBJTQB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |