C12H28O6 — CID 160972602
2,2-dimethoxypropane;dimethyl carbonate;ethoxyethane (PubChem CID 160972602) has the molecular formula C12H28O6 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2,2-dimethoxypropane;dimethyl carbonate;ethoxyethane.
| Compound Name | 2,2-dimethoxypropane;dimethyl carbonate;ethoxyethane |
|---|---|
| PubChem CID | 160972602 |
| Molecular Formula | C12H28O6 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,2-dimethoxypropane;dimethyl carbonate;ethoxyethane |
| SMILES | CCOCC.COC(=O)OC.COC(C)(C)OC |
| InChI | InChI=1S/C5H12O2.C4H10O.C3H6O3/c1-5(2,6-3)7-4;1-3-5-4-2;1-5-3(4)6-2/h1-4H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | SYLLICFEISZVNP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|