C61H38F3N3O4S2 — CID 160972856
[4-(N-dibenzofuran-2-ylanilino)-8-[3-(N-(9-phenylcarbazol-4-yl)anilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 160972856) has the molecular formula C61H38F3N3O4S2 and a molecular weight of 998.12 g/mol. Its IUPAC name is [4-(N-dibenzofuran-2-ylanilino)-8-[3-(N-(9-phenylcarbazol-4-yl)anilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzofuran-2-ylanilino)-8-[3-(N-(9-phenylcarbazol-4-yl)anilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160972856 |
| Molecular Formula | C61H38F3N3O4S2 |
| Molecular Weight | 998.12 g/mol |
| Exact Mass | 997.23 |
| IUPAC Name | [4-(N-dibenzofuran-2-ylanilino)-8-[3-(N-(9-phenylcarbazol-4-yl)anilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3oc4ccccc4c3c2)c2sc3ccc(-c4cccc(N(c5ccccc5)c5cccc6c5c5ccccc5n6-c5ccccc5)c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C61H38F3N3O4S2/c62-61(63,64)73(68,69)71-46-37-51-50-35-40(30-33-58(50)72-60(51)55(38-46)66(42-19-6-2-7-20-42)45-31-32-57-49(36-45)47-24-11-13-29-56(47)70-57)39-16-14-23-44(34-39)65(41-17-4-1-5-18-41)53-27-15-28-54-59(53)48-25-10-12-26-52(48)67(54)43-21-8-3-9-22-43/h1-38H |
| InChIKey | HKSFFCGFHTYELA-UHFFFAOYSA-N |
| XLogP | 17.89 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.12 |
| LogP ≤ 5 | 17.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|