C31H39N3O6 — CID 160975671
ethyl N-[4-[(5S)-6-amino-1-[4-(ethoxycarbonylamino)phenyl]-5-hydroxy-3-methyl-6-phenoxyhexyl]phenyl]carbamate (PubChem CID 160975671) has the molecular formula C31H39N3O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is ethyl N-[4-[(5S)-6-amino-1-[4-(ethoxycarbonylamino)phenyl]-5-hydroxy-3-methyl-6-phenoxyhexyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(5S)-6-amino-1-[4-(ethoxycarbonylamino)phenyl]-5-hydroxy-3-methyl-6-phenoxyhexyl]phenyl]carbamate |
|---|---|
| PubChem CID | 160975671 |
| Molecular Formula | C31H39N3O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | ethyl N-[4-[(5S)-6-amino-1-[4-(ethoxycarbonylamino)phenyl]-5-hydroxy-3-methyl-6-phenoxyhexyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C(CC(C)C[C@H](O)C(N)Oc2ccccc2)c2ccc(NC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C31H39N3O6/c1-4-38-30(36)33-24-15-11-22(12-16-24)27(23-13-17-25(18-14-23)34-31(37)39-5-2)19-21(3)20-28(35)29(32)40-26-9-7-6-8-10-26/h6-18,21,27-29,35H,4-5,19-20,32H2,1-3H3,(H,33,36)(H,34,37)/t21?,28-,29?/m0/s1 |
| InChIKey | SYVHELOEHYWGRU-QGEOKYBTSA-N |
| XLogP | 6.10 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|