C15H22N2O4 — CID 99794465
ethyl N-[4-[[(2R,3R)-2-ethyl-3-hydroxybutanoyl]amino]phenyl]carbamate (PubChem CID 99794465) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl N-[4-[[(2R,3R)-2-ethyl-3-hydroxybutanoyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[(2R,3R)-2-ethyl-3-hydroxybutanoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 99794465 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl N-[4-[[(2R,3R)-2-ethyl-3-hydroxybutanoyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(=O)[C@H](CC)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-4-13(10(3)18)14(19)16-11-6-8-12(9-7-11)17-15(20)21-5-2/h6-10,13,18H,4-5H2,1-3H3,(H,16,19)(H,17,20)/t10-,13-/m1/s1 |
| InChIKey | QHCVURKACRZPBX-ZWNOBZJWSA-N |
| XLogP | 2.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |