C25H29F6NO8S2 — CID 160984609
tert-butyl 3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidine-1-carboxylate;2,2,2-trifluoroethyl trifluoromethanesulfonate (PubChem CID 160984609) has the molecular formula C25H29F6NO8S2 and a molecular weight of 649.63 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidine-1-carboxylate;2,2,2-trifluoroethyl trifluoromethanesulfonate.
| Compound Name | tert-butyl 3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidine-1-carboxylate;2,2,2-trifluoroethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160984609 |
| Molecular Formula | C25H29F6NO8S2 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | tert-butyl 3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidine-1-carboxylate;2,2,2-trifluoroethyl trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N1CC(COc2ccc(-c3ccc(S(C)(=O)=O)cc3)cc2)C1.O=S(=O)(OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H27NO5S.C3H2F6O3S/c1-22(2,3)28-21(24)23-13-16(14-23)15-27-19-9-5-17(6-10-19)18-7-11-20(12-8-18)29(4,25)26;4-2(5,6)1-12-13(10,11)3(7,8)9/h5-12,16H,13-15H2,1-4H3;1H2 |
| InChIKey | SZYPWMVGCLUAQR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|