C7H10F2N2O2 — CID 160988766
2,2-difluoroacetic acid;(3S)-pyrrolidine-3-carbonitrile (PubChem CID 160988766) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.16 g/mol. Its IUPAC name is 2,2-difluoroacetic acid;(3S)-pyrrolidine-3-carbonitrile.
| Compound Name | 2,2-difluoroacetic acid;(3S)-pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 160988766 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2,2-difluoroacetic acid;(3S)-pyrrolidine-3-carbonitrile |
| SMILES | N#C[C@H]1CCNC1.O=C(O)C(F)F |
| InChI | InChI=1S/C5H8N2.C2H2F2O2/c6-3-5-1-2-7-4-5;3-1(4)2(5)6/h5,7H,1-2,4H2;1H,(H,5,6)/t5-;/m1./s1 |
| InChIKey | TUIMZRDIQKMKRW-NUBCRITNSA-N |
| XLogP | 0.46 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |