C26H33N3O4 — CID 160992934
4-aminophenol;(4-aminophenyl) octanoate;4-iminocyclohexa-2,5-dien-1-one (PubChem CID 160992934) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 4-aminophenol;(4-aminophenyl) octanoate;4-iminocyclohexa-2,5-dien-1-one.
| Compound Name | 4-aminophenol;(4-aminophenyl) octanoate;4-iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 160992934 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 4-aminophenol;(4-aminophenyl) octanoate;4-iminocyclohexa-2,5-dien-1-one |
| SMILES | CCCCCCCC(=O)Oc1ccc(N)cc1.Nc1ccc(O)cc1.[H]N=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C14H21NO2.C6H7NO.C6H5NO/c1-2-3-4-5-6-7-14(16)17-13-10-8-12(15)9-11-13;2*7-5-1-3-6(8)4-2-5/h8-11H,2-7,15H2,1H3;1-4,8H,7H2;1-4,7H |
| InChIKey | TUWMOLUFYGZPFT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|