C15H6Cl4F3IN4 — CID 160998031
2,5-dichloro-4-iodopyridine;5-(2,5-dichloro-4-pyridinyl)-2-(trifluoromethyl)pyrimidine (PubChem CID 160998031) has the molecular formula C15H6Cl4F3IN4 and a molecular weight of 567.95 g/mol. Its IUPAC name is 2,5-dichloro-4-iodopyridine;5-(2,5-dichloro-4-pyridinyl)-2-(trifluoromethyl)pyrimidine.
| Compound Name | 2,5-dichloro-4-iodopyridine;5-(2,5-dichloro-4-pyridinyl)-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 160998031 |
| Molecular Formula | C15H6Cl4F3IN4 |
| Molecular Weight | 567.95 g/mol |
| Exact Mass | 565.83 |
| IUPAC Name | 2,5-dichloro-4-iodopyridine;5-(2,5-dichloro-4-pyridinyl)-2-(trifluoromethyl)pyrimidine |
| SMILES | Clc1cc(I)c(Cl)cn1.FC(F)(F)c1ncc(-c2cc(Cl)ncc2Cl)cn1 |
| InChI | InChI=1S/C10H4Cl2F3N3.C5H2Cl2IN/c11-7-4-16-8(12)1-6(7)5-2-17-9(18-3-5)10(13,14)15;6-3-2-9-5(7)1-4(3)8/h1-4H;1-2H |
| InChIKey | TVMSNWNVPYPKKY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.95 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|