C11H17BrN4O2S — CID 161008267
ethyl (4S)-2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate;hydrobromide (PubChem CID 161008267) has the molecular formula C11H17BrN4O2S and a molecular weight of 349.25 g/mol. Its IUPAC name is ethyl (4S)-2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate;hydrobromide.
| Compound Name | ethyl (4S)-2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 161008267 |
| Molecular Formula | C11H17BrN4O2S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | ethyl (4S)-2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)[C@H]1CCCc2sc(N=C(N)N)nc21 |
| InChI | InChI=1S/C11H16N4O2S.BrH/c1-2-17-9(16)6-4-3-5-7-8(6)14-11(18-7)15-10(12)13;/h6H,2-5H2,1H3,(H4,12,13,14,15);1H/t6-;/m0./s1 |
| InChIKey | AOAUYBIEOIXKSR-RGMNGODLSA-N |
| XLogP | 1.61 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|