C18H23N5O2S — CID 87957103
[2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl] N-methyl-N-(2-phenylethyl)carbamate (PubChem CID 87957103) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is [2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl] N-methyl-N-(2-phenylethyl)carbamate.
| Compound Name | [2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl] N-methyl-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 87957103 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-(diaminomethylideneamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl] N-methyl-N-(2-phenylethyl)carbamate |
| SMILES | CN(CCc1ccccc1)C(=O)OC1CCCc2sc(N=C(N)N)nc21 |
| InChI | InChI=1S/C18H23N5O2S/c1-23(11-10-12-6-3-2-4-7-12)18(24)25-13-8-5-9-14-15(13)21-17(26-14)22-16(19)20/h2-4,6-7,13H,5,8-11H2,1H3,(H4,19,20,21,22) |
| InChIKey | OAZUCTSIKNGXEQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|