C15H17N5OS — CID 10087063
2-(diaminomethylideneamino)-N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 10087063) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(diaminomethylideneamino)-N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 10087063 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | NC(N)=Nc1nc2c(s1)CC(C(=O)Nc1ccccc1)CC2 |
| InChI | InChI=1S/C15H17N5OS/c16-14(17)20-15-19-11-7-6-9(8-12(11)22-15)13(21)18-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,18,21)(H4,16,17,19,20) |
| InChIKey | QMAOJYKWYMFLDP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|