C18H32N4O4 — CID 161010004
1-methyl-2-oxo-N-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 161010004) has the molecular formula C18H32N4O4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 161010004 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-methyl-2-oxo-N-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1CCN(C)C1=O.CC(C)NC(=O)C1CCN(C)C1=O |
| InChI | InChI=1S/2C9H16N2O2/c2*1-6(2)10-8(12)7-4-5-11(3)9(7)13/h2*6-7H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | TWZYBJBUDCRGEY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|