C15H17ClN4O — CID 161011840
8'-but-3-en-2-yl-2'-chloro-5'-ethenylspiro[cyclobutane-1,7'-pteridine]-6'-one (PubChem CID 161011840) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 8'-but-3-en-2-yl-2'-chloro-5'-ethenylspiro[cyclobutane-1,7'-pteridine]-6'-one.
| Compound Name | 8'-but-3-en-2-yl-2'-chloro-5'-ethenylspiro[cyclobutane-1,7'-pteridine]-6'-one |
|---|---|
| PubChem CID | 161011840 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 8'-but-3-en-2-yl-2'-chloro-5'-ethenylspiro[cyclobutane-1,7'-pteridine]-6'-one |
| SMILES | C=CC(C)N1c2nc(Cl)ncc2N(C=C)C(=O)C12CCC2 |
| InChI | InChI=1S/C15H17ClN4O/c1-4-10(3)20-12-11(9-17-14(16)18-12)19(5-2)13(21)15(20)7-6-8-15/h4-5,9-10H,1-2,6-8H2,3H3 |
| InChIKey | TXFKKAAJLZILEP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|