C9H12N2O2 — CID 130120413
3-ethenyl-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 130120413) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-ethenyl-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-ethenyl-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 130120413 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-ethenyl-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | C=CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C9H12N2O2/c1-2-11-7(12)9(10-8(11)13)5-3-4-6-9/h2H,1,3-6H2,(H,10,13) |
| InChIKey | MZZWWGLYCCLBRT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|