C15H21BrN2O2 — CID 161012593
ethyl 2-[(2S,6R)-6-(4-bromophenyl)-4-methylpiperazin-2-yl]acetate (PubChem CID 161012593) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is ethyl 2-[(2S,6R)-6-(4-bromophenyl)-4-methylpiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,6R)-6-(4-bromophenyl)-4-methylpiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 161012593 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | ethyl 2-[(2S,6R)-6-(4-bromophenyl)-4-methylpiperazin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CN(C)C[C@@H](c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-3-20-15(19)8-13-9-18(2)10-14(17-13)11-4-6-12(16)7-5-11/h4-7,13-14,17H,3,8-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | IHPKLJNGLHZKPU-KBPBESRZSA-N |
| XLogP | 2.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |