C40H41F2N5O5 — CID 161015547
3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-[[3-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]phenyl]methyl]-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one (PubChem CID 161015547) has the molecular formula C40H41F2N5O5 and a molecular weight of 709.79 g/mol. Its IUPAC name is 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-[[3-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]phenyl]methyl]-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-[[3-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]phenyl]methyl]-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 161015547 |
| Molecular Formula | C40H41F2N5O5 |
| Molecular Weight | 709.79 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-[[3-[(E)-5-(dimethylamino)-2-oxopent-3-enyl]phenyl]methyl]-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one |
| SMILES | COc1cc(OC)c(F)c(-c2cc3cnc(Nc4ccc(N5CCOCC5)cc4)cc3n(Cc3cccc(CC(=O)/C=C/CN(C)C)c3)c2=O)c1F |
| InChI | InChI=1S/C40H41F2N5O5/c1-45(2)14-6-9-31(48)20-26-7-5-8-27(19-26)25-47-33-22-36(44-29-10-12-30(13-11-29)46-15-17-52-18-16-46)43-24-28(33)21-32(40(47)49)37-38(41)34(50-3)23-35(51-4)39(37)42/h5-13,19,21-24H,14-18,20,25H2,1-4H3,(H,43,44)/b9-6+ |
| InChIKey | YQDXKPCMFWJQPW-RMKNXTFCSA-N |
| XLogP | 6.22 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.79 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|