C35H39F2N9O3 — CID 146412360
(E)-N-[2-[[4-(2,6-difluoro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 146412360) has the molecular formula C35H39F2N9O3 and a molecular weight of 671.75 g/mol. Its IUPAC name is (E)-N-[2-[[4-(2,6-difluoro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[2-[[4-(2,6-difluoro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 146412360 |
| Molecular Formula | C35H39F2N9O3 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | (E)-N-[2-[[4-(2,6-difluoro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-5-(4-ethylpiperazin-1-yl)phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCN1CCN(c2ccc(Nc3cc4c(cn3)cc(-c3c(F)c(OC)cc(OC)c3F)c3ncnn34)c(NC(=O)/C=C/CN(C)C)c2)CC1 |
| InChI | InChI=1S/C35H39F2N9O3/c1-6-44-12-14-45(15-13-44)23-9-10-25(26(17-23)42-31(47)8-7-11-43(2)3)41-30-18-27-22(20-38-30)16-24(35-39-21-40-46(27)35)32-33(36)28(48-4)19-29(49-5)34(32)37/h7-10,16-21H,6,11-15H2,1-5H3,(H,38,41)(H,42,47)/b8-7+ |
| InChIKey | VQGVROKYNKMJRN-BQYQJAHWSA-N |
| XLogP | 5.18 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|