C22H24O10 — CID 161017008
ethyl 5-formyl-2,4-dihydroxybenzoate;ethyl 5-formyl-2,4-dimethoxybenzoate (PubChem CID 161017008) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is ethyl 5-formyl-2,4-dihydroxybenzoate;ethyl 5-formyl-2,4-dimethoxybenzoate.
| Compound Name | ethyl 5-formyl-2,4-dihydroxybenzoate;ethyl 5-formyl-2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 161017008 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | ethyl 5-formyl-2,4-dihydroxybenzoate;ethyl 5-formyl-2,4-dimethoxybenzoate |
| SMILES | CCOC(=O)c1cc(C=O)c(O)cc1O.CCOC(=O)c1cc(C=O)c(OC)cc1OC |
| InChI | InChI=1S/C12H14O5.C10H10O5/c1-4-17-12(14)9-5-8(7-13)10(15-2)6-11(9)16-3;1-2-15-10(14)7-3-6(5-11)8(12)4-9(7)13/h5-7H,4H2,1-3H3;3-5,12-13H,2H2,1H3 |
| InChIKey | TXVYMYFXXHXNDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|