C16H16F2N3O3Y- — CID 161018845
2-[(2,5-difluorophenyl)methyl]-5-(oxomethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione;ethane;yttrium (PubChem CID 161018845) has the molecular formula C16H16F2N3O3Y- and a molecular weight of 425.22 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-5-(oxomethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione;ethane;yttrium.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-5-(oxomethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione;ethane;yttrium |
|---|---|
| PubChem CID | 161018845 |
| Molecular Formula | C16H16F2N3O3Y- |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-5-(oxomethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione;ethane;yttrium |
| SMILES | CC.O=[C-]C1C=CCn2c(=O)n(Cc3cc(F)ccc3F)c(=O)n21.[Y] |
| InChI | InChI=1S/C14H10F2N3O3.C2H6.Y/c15-10-3-4-12(16)9(6-10)7-17-13(21)18-5-1-2-11(8-20)19(18)14(17)22;1-2;/h1-4,6,11H,5,7H2;1-2H3;/q-1;; |
| InChIKey | XHVOWIQDLDRJPZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|