C19H26F2N2O2 — CID 176613572
1-[(3,4-difluorophenyl)methyl]-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione (PubChem CID 176613572) has the molecular formula C19H26F2N2O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 176613572 |
| Molecular Formula | C19H26F2N2O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N(Cc2ccc(F)c(F)c2)C(C(C)C)(C(C)C)C1=O |
| InChI | InChI=1S/C19H26F2N2O2/c1-11(2)19(12(3)4)17(24)23(13(5)6)18(25)22(19)10-14-7-8-15(20)16(21)9-14/h7-9,11-13H,10H2,1-6H3 |
| InChIKey | QOTTXVOVKJXNHV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|