C24H20BrNO — CID 161024379
[4-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methanol (PubChem CID 161024379) has the molecular formula C24H20BrNO and a molecular weight of 418.33 g/mol. Its IUPAC name is [4-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methanol.
| Compound Name | [4-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 161024379 |
| Molecular Formula | C24H20BrNO |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [4-[5-(4-bromophenyl)-1-(2-methylphenyl)pyrrol-2-yl]phenyl]methanol |
| SMILES | Cc1ccccc1-n1c(-c2ccc(Br)cc2)ccc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C24H20BrNO/c1-17-4-2-3-5-22(17)26-23(19-8-6-18(16-27)7-9-19)14-15-24(26)20-10-12-21(25)13-11-20/h2-15,27H,16H2,1H3 |
| InChIKey | IJPTZJVGXNTKBX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |