C23H25F3N4O — CID 161024642
2-methyl-5-[3-[(1-phenylcyclohexyl)methoxymethyl]-5-(trifluoromethyl)phenyl]tetrazole (PubChem CID 161024642) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-methyl-5-[3-[(1-phenylcyclohexyl)methoxymethyl]-5-(trifluoromethyl)phenyl]tetrazole.
| Compound Name | 2-methyl-5-[3-[(1-phenylcyclohexyl)methoxymethyl]-5-(trifluoromethyl)phenyl]tetrazole |
|---|---|
| PubChem CID | 161024642 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-methyl-5-[3-[(1-phenylcyclohexyl)methoxymethyl]-5-(trifluoromethyl)phenyl]tetrazole |
| SMILES | Cn1nnc(-c2cc(COCC3(c4ccccc4)CCCCC3)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H25F3N4O/c1-30-28-21(27-29-30)18-12-17(13-20(14-18)23(24,25)26)15-31-16-22(10-6-3-7-11-22)19-8-4-2-5-9-19/h2,4-5,8-9,12-14H,3,6-7,10-11,15-16H2,1H3 |
| InChIKey | YNPVYJNAHARNJB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |