C19H25F3N4O — CID 174311200
5-[2-(2-methylpropoxymethyl)-6-[4-(trifluoromethyl)cyclohexyl]phenyl]-2H-tetrazole (PubChem CID 174311200) has the molecular formula C19H25F3N4O and a molecular weight of 382.43 g/mol. Its IUPAC name is 5-[2-(2-methylpropoxymethyl)-6-[4-(trifluoromethyl)cyclohexyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-(2-methylpropoxymethyl)-6-[4-(trifluoromethyl)cyclohexyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 174311200 |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 5-[2-(2-methylpropoxymethyl)-6-[4-(trifluoromethyl)cyclohexyl]phenyl]-2H-tetrazole |
| SMILES | CC(C)COCc1cccc(C2CCC(C(F)(F)F)CC2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C19H25F3N4O/c1-12(2)10-27-11-14-4-3-5-16(17(14)18-23-25-26-24-18)13-6-8-15(9-7-13)19(20,21)22/h3-5,12-13,15H,6-11H2,1-2H3,(H,23,24,25,26) |
| InChIKey | BUQOQZNDMDMUIC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |