C24H14F8N8O2 — CID 164848538
5-[4-[2,5-bis(methoxymethyl)-4-[2,3,5,6-tetrafluoro-4-(2H-tetrazol-5-yl)phenyl]phenyl]-2,3,5,6-tetrafluorophenyl]-2H-tetrazole (PubChem CID 164848538) has the molecular formula C24H14F8N8O2 and a molecular weight of 598.41 g/mol. Its IUPAC name is 5-[4-[2,5-bis(methoxymethyl)-4-[2,3,5,6-tetrafluoro-4-(2H-tetrazol-5-yl)phenyl]phenyl]-2,3,5,6-tetrafluorophenyl]-2H-tetrazole.
| Compound Name | 5-[4-[2,5-bis(methoxymethyl)-4-[2,3,5,6-tetrafluoro-4-(2H-tetrazol-5-yl)phenyl]phenyl]-2,3,5,6-tetrafluorophenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 164848538 |
| Molecular Formula | C24H14F8N8O2 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | 5-[4-[2,5-bis(methoxymethyl)-4-[2,3,5,6-tetrafluoro-4-(2H-tetrazol-5-yl)phenyl]phenyl]-2,3,5,6-tetrafluorophenyl]-2H-tetrazole |
| SMILES | COCc1cc(-c2c(F)c(F)c(-c3nn[nH]n3)c(F)c2F)c(COC)cc1-c1c(F)c(F)c(-c2nn[nH]n2)c(F)c1F |
| InChI | InChI=1S/C24H14F8N8O2/c1-41-5-7-3-10(12-17(27)21(31)14(22(32)18(12)28)24-35-39-40-36-24)8(6-42-2)4-9(7)11-15(25)19(29)13(20(30)16(11)26)23-33-37-38-34-23/h3-4H,5-6H2,1-2H3,(H,33,34,37,38)(H,35,36,39,40) |
| InChIKey | HAIVQPUKDJIRHQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|