C24H28O6 — CID 161024842
4-hydroxy-2-(3-methylbut-3-enyl)benzoic acid;3-methylbut-3-enyl 4-hydroxybenzoate (PubChem CID 161024842) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 4-hydroxy-2-(3-methylbut-3-enyl)benzoic acid;3-methylbut-3-enyl 4-hydroxybenzoate.
| Compound Name | 4-hydroxy-2-(3-methylbut-3-enyl)benzoic acid;3-methylbut-3-enyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 161024842 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-hydroxy-2-(3-methylbut-3-enyl)benzoic acid;3-methylbut-3-enyl 4-hydroxybenzoate |
| SMILES | C=C(C)CCOC(=O)c1ccc(O)cc1.C=C(C)CCc1cc(O)ccc1C(=O)O |
| InChI | InChI=1S/2C12H14O3/c1-9(2)7-8-15-12(14)10-3-5-11(13)6-4-10;1-8(2)3-4-9-7-10(13)5-6-11(9)12(14)15/h3-6,13H,1,7-8H2,2H3;5-7,13H,1,3-4H2,2H3,(H,14,15) |
| InChIKey | TYVPKHCGIMRUSI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|