C6H7Cl4N2+ — CID 161028117
1-methyl-3-(1,2,2,2-tetrachloroethyl)imidazol-1-ium (PubChem CID 161028117) has the molecular formula C6H7Cl4N2+ and a molecular weight of 248.95 g/mol. Its IUPAC name is 1-methyl-3-(1,2,2,2-tetrachloroethyl)imidazol-1-ium.
| Compound Name | 1-methyl-3-(1,2,2,2-tetrachloroethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 161028117 |
| Molecular Formula | C6H7Cl4N2+ |
| Molecular Weight | 248.95 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 1-methyl-3-(1,2,2,2-tetrachloroethyl)imidazol-1-ium |
| SMILES | C[n+]1ccn(C(Cl)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C6H7Cl4N2/c1-11-2-3-12(4-11)5(7)6(8,9)10/h2-5H,1H3/q+1 |
| InChIKey | VWRFIRJNGAARGS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.95 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|