C9H18BrN3 — CID 87121443
N,N-dimethyl-1-(3-methylimidazol-3-ium-1-yl)propan-1-amine bromide (PubChem CID 87121443) has the molecular formula C9H18BrN3 and a molecular weight of 248.17 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-methylimidazol-3-ium-1-yl)propan-1-amine bromide.
| Compound Name | N,N-dimethyl-1-(3-methylimidazol-3-ium-1-yl)propan-1-amine bromide |
|---|---|
| PubChem CID | 87121443 |
| Molecular Formula | C9H18BrN3 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N,N-dimethyl-1-(3-methylimidazol-3-ium-1-yl)propan-1-amine bromide |
| SMILES | CCC(N(C)C)n1cc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C9H18N3.BrH/c1-5-9(10(2)3)12-7-6-11(4)8-12;/h6-9H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | WJYKVXZNBRMRDQ-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|